C13H23N3O5 — CID 141089290
[(2R,3S,4R)-2-azido-3,4-dihydroxyoxolan-2-yl]methyl octanoate (PubChem CID 141089290) has the molecular formula C13H23N3O5 and a molecular weight of 301.34 g/mol. Its IUPAC name is [(2R,3S,4R)-2-azido-3,4-dihydroxyoxolan-2-yl]methyl octanoate.
| Compound Name | [(2R,3S,4R)-2-azido-3,4-dihydroxyoxolan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 141089290 |
| Molecular Formula | C13H23N3O5 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | [(2R,3S,4R)-2-azido-3,4-dihydroxyoxolan-2-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OC[C@@]1(N=[N+]=[N-])OC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H23N3O5/c1-2-3-4-5-6-7-11(18)20-9-13(15-16-14)12(19)10(17)8-21-13/h10,12,17,19H,2-9H2,1H3/t10-,12+,13-/m1/s1 |
| InChIKey | COXFQSNOVALNSL-KGYLQXTDSA-N |
| XLogP | 1.65 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|