C24H32O6 — CID 73072231
(10-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl) decanoate (PubChem CID 73072231) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is (10-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl) decanoate.
| Compound Name | (10-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl) decanoate |
|---|---|
| PubChem CID | 73072231 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (10-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl) decanoate |
| SMILES | CCCCCCCCCC(=O)OC1C(O)c2c(ccc3ccc(=O)oc23)OC1(C)C |
| InChI | InChI=1S/C24H32O6/c1-4-5-6-7-8-9-10-11-18(25)29-23-21(27)20-17(30-24(23,2)3)14-12-16-13-15-19(26)28-22(16)20/h12-15,21,23,27H,4-11H2,1-3H3 |
| InChIKey | MVGSSLGEJSXBBZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|