C16H16O6 — CID 78385435
(4-hydroxy-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) acetate (PubChem CID 78385435) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is (4-hydroxy-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) acetate.
| Compound Name | (4-hydroxy-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) acetate |
|---|---|
| PubChem CID | 78385435 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (4-hydroxy-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) acetate |
| SMILES | CC(=O)OC1C(O)c2cc3ccc(=O)oc3cc2OC1(C)C |
| InChI | InChI=1S/C16H16O6/c1-8(17)20-15-14(19)10-6-9-4-5-13(18)21-11(9)7-12(10)22-16(15,2)3/h4-7,14-15,19H,1-3H3 |
| InChIKey | CLTUXUGTKSQSBM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|