C19H19NO5 — CID 44518620
N-(2,2-dimethyl-4,8-dioxo-3H-pyrano[3,2-g]chromen-3-yl)-3-methylbut-2-enamide (PubChem CID 44518620) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is N-(2,2-dimethyl-4,8-dioxo-3H-pyrano[3,2-g]chromen-3-yl)-3-methylbut-2-enamide.
| Compound Name | N-(2,2-dimethyl-4,8-dioxo-3H-pyrano[3,2-g]chromen-3-yl)-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 44518620 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-(2,2-dimethyl-4,8-dioxo-3H-pyrano[3,2-g]chromen-3-yl)-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)NC1C(=O)c2cc3ccc(=O)oc3cc2OC1(C)C |
| InChI | InChI=1S/C19H19NO5/c1-10(2)7-15(21)20-18-17(23)12-8-11-5-6-16(22)24-13(11)9-14(12)25-19(18,3)4/h5-9,18H,1-4H3,(H,20,21) |
| InChIKey | BDEVFIODMXUAJC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|