C24H26O8 — CID 162938486
[(3S,4S)-2,2-dimethyl-3-(2-methylbut-2-enoyloxy)-8-oxo-3,4-dihydropyrano[3,2-g]chromen-4-yl] (2R,3S)-2,3-dimethyloxirane-2-carboxylate (PubChem CID 162938486) has the molecular formula C24H26O8 and a molecular weight of 442.46 g/mol. Its IUPAC name is [(3S,4S)-2,2-dimethyl-3-(2-methylbut-2-enoyloxy)-8-oxo-3,4-dihydropyrano[3,2-g]chromen-4-yl] (2R,3S)-2,3-dimethyloxirane-2-carboxylate.
| Compound Name | [(3S,4S)-2,2-dimethyl-3-(2-methylbut-2-enoyloxy)-8-oxo-3,4-dihydropyrano[3,2-g]chromen-4-yl] (2R,3S)-2,3-dimethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 162938486 |
| Molecular Formula | C24H26O8 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [(3S,4S)-2,2-dimethyl-3-(2-methylbut-2-enoyloxy)-8-oxo-3,4-dihydropyrano[3,2-g]chromen-4-yl] (2R,3S)-2,3-dimethyloxirane-2-carboxylate |
| SMILES | CC=C(C)C(=O)O[C@H]1[C@@H](OC(=O)[C@]2(C)O[C@H]2C)c2cc3ccc(=O)oc3cc2OC1(C)C |
| InChI | InChI=1S/C24H26O8/c1-7-12(2)21(26)30-20-19(29-22(27)24(6)13(3)31-24)15-10-14-8-9-18(25)28-16(14)11-17(15)32-23(20,4)5/h7-11,13,19-20H,1-6H3/t13-,19-,20-,24+/m0/s1 |
| InChIKey | SHZIIRHXBSCNRY-SWFLFHOGSA-N |
| XLogP | 3.60 |
| TPSA | 104.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|