C23H24O7S — CID 71436985
[8,8-dimethyl-10-(3-methylsulfanylprop-2-enoyloxy)-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] 2-methylbut-2-enoate (PubChem CID 71436985) has the molecular formula C23H24O7S and a molecular weight of 444.51 g/mol. Its IUPAC name is [8,8-dimethyl-10-(3-methylsulfanylprop-2-enoyloxy)-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] 2-methylbut-2-enoate.
| Compound Name | [8,8-dimethyl-10-(3-methylsulfanylprop-2-enoyloxy)-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 71436985 |
| Molecular Formula | C23H24O7S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | [8,8-dimethyl-10-(3-methylsulfanylprop-2-enoyloxy)-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C(OC(=O)C=CSC)c2c(ccc3ccc(=O)oc23)OC1(C)C |
| InChI | InChI=1S/C23H24O7S/c1-6-13(2)22(26)29-21-20(28-17(25)11-12-31-5)18-15(30-23(21,3)4)9-7-14-8-10-16(24)27-19(14)18/h6-12,20-21H,1-5H3 |
| InChIKey | VZCQZASXHFXLSM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|