C22H24O7 — CID 10453592
(10-acetyloxy-3,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl) (Z)-2-methylbut-2-enoate (PubChem CID 10453592) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is (10-acetyloxy-3,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl) (Z)-2-methylbut-2-enoate.
| Compound Name | (10-acetyloxy-3,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl) (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 10453592 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (10-acetyloxy-3,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl) (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC1C(OC(C)=O)c2c(ccc3cc(C)c(=O)oc23)OC1(C)C |
| InChI | InChI=1S/C22H24O7/c1-7-11(2)20(24)28-19-18(26-13(4)23)16-15(29-22(19,5)6)9-8-14-10-12(3)21(25)27-17(14)16/h7-10,18-19H,1-6H3/b11-7- |
| InChIKey | LGKHTHDFBCHAJU-XFFZJAGNSA-N |
| XLogP | 3.75 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|