C21H22O6 — CID 10022049
[8,8-dimethyl-9-[(Z)-2-methylbut-2-enoyl]-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] acetate (PubChem CID 10022049) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is [8,8-dimethyl-9-[(Z)-2-methylbut-2-enoyl]-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] acetate.
| Compound Name | [8,8-dimethyl-9-[(Z)-2-methylbut-2-enoyl]-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] acetate |
|---|---|
| PubChem CID | 10022049 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [8,8-dimethyl-9-[(Z)-2-methylbut-2-enoyl]-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] acetate |
| SMILES | C/C=C(/C)C(=O)C1C(OC(C)=O)c2c(ccc3ccc(=O)oc23)OC1(C)C |
| InChI | InChI=1S/C21H22O6/c1-6-11(2)18(24)17-20(25-12(3)22)16-14(27-21(17,4)5)9-7-13-8-10-15(23)26-19(13)16/h6-10,17,20H,1-5H3/b11-6- |
| InChIKey | PUFUHMFEQZRTBN-WDZFZDKYSA-N |
| XLogP | 3.72 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|