C21H22O6S — CID 123470921
[8,8-dimethyl-10-(2-methylbut-2-enoylsulfanyl)-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] acetate (PubChem CID 123470921) has the molecular formula C21H22O6S and a molecular weight of 402.47 g/mol. Its IUPAC name is [8,8-dimethyl-10-(2-methylbut-2-enoylsulfanyl)-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] acetate.
| Compound Name | [8,8-dimethyl-10-(2-methylbut-2-enoylsulfanyl)-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] acetate |
|---|---|
| PubChem CID | 123470921 |
| Molecular Formula | C21H22O6S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | [8,8-dimethyl-10-(2-methylbut-2-enoylsulfanyl)-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] acetate |
| SMILES | CC=C(C)C(=O)SC1c2c(ccc3ccc(=O)oc23)OC(C)(C)C1OC(C)=O |
| InChI | InChI=1S/C21H22O6S/c1-6-11(2)20(24)28-18-16-14(27-21(4,5)19(18)25-12(3)22)9-7-13-8-10-15(23)26-17(13)16/h6-10,18-19H,1-5H3 |
| InChIKey | FWHWIEUQHGXKRQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|