C19H20O5 — CID 162987193
[(8R)-7,7-dimethyl-2-oxo-6,8-dihydropyrano[3,2-g]chromen-8-yl] 3-methylbut-2-enoate (PubChem CID 162987193) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is [(8R)-7,7-dimethyl-2-oxo-6,8-dihydropyrano[3,2-g]chromen-8-yl] 3-methylbut-2-enoate.
| Compound Name | [(8R)-7,7-dimethyl-2-oxo-6,8-dihydropyrano[3,2-g]chromen-8-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 162987193 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [(8R)-7,7-dimethyl-2-oxo-6,8-dihydropyrano[3,2-g]chromen-8-yl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)O[C@H]1Oc2cc3oc(=O)ccc3cc2CC1(C)C |
| InChI | InChI=1S/C19H20O5/c1-11(2)7-17(21)24-18-19(3,4)10-13-8-12-5-6-16(20)22-14(12)9-15(13)23-18/h5-9,18H,10H2,1-4H3/t18-/m1/s1 |
| InChIKey | JXZWWIMXTVJNSF-GOSISDBHSA-N |
| XLogP | 3.59 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|