C19H20O7 — CID 11256929
[(3S,4S)-3-acetyloxy-2,2,6-trimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-4-yl] acetate (PubChem CID 11256929) has the molecular formula C19H20O7 and a molecular weight of 360.36 g/mol. Its IUPAC name is [(3S,4S)-3-acetyloxy-2,2,6-trimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-4-yl] acetate.
| Compound Name | [(3S,4S)-3-acetyloxy-2,2,6-trimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-4-yl] acetate |
|---|---|
| PubChem CID | 11256929 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | [(3S,4S)-3-acetyloxy-2,2,6-trimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1c2cc3c(C)cc(=O)oc3cc2OC(C)(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H20O7/c1-9-6-16(22)25-14-8-15-13(7-12(9)14)17(23-10(2)20)18(24-11(3)21)19(4,5)26-15/h6-8,17-18H,1-5H3/t17-,18-/m0/s1 |
| InChIKey | VSZZILNDQDZFCX-ROUUACIJSA-N |
| XLogP | 2.81 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|