C16H18O5 — CID 59973745
(9R,10R)-9,10-dimethoxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one (PubChem CID 59973745) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is (9R,10R)-9,10-dimethoxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one.
| Compound Name | (9R,10R)-9,10-dimethoxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one |
|---|---|
| PubChem CID | 59973745 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (9R,10R)-9,10-dimethoxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one |
| SMILES | CO[C@@H]1c2c(ccc3ccc(=O)oc23)OC(C)(C)[C@@H]1OC |
| InChI | InChI=1S/C16H18O5/c1-16(2)15(19-4)14(18-3)12-10(21-16)7-5-9-6-8-11(17)20-13(9)12/h5-8,14-15H,1-4H3/t14-,15-/m1/s1 |
| InChIKey | DDIJCQQECYDBJB-HUUCEWRRSA-N |
| XLogP | 2.67 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|