C20H27NO5 — CID 23621215
10-[2-(diethylamino)ethoxy]-9-hydroxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one (PubChem CID 23621215) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is 10-[2-(diethylamino)ethoxy]-9-hydroxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one.
| Compound Name | 10-[2-(diethylamino)ethoxy]-9-hydroxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one |
|---|---|
| PubChem CID | 23621215 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 10-[2-(diethylamino)ethoxy]-9-hydroxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one |
| SMILES | CCN(CC)CCOC1c2c(ccc3ccc(=O)oc23)OC(C)(C)C1O |
| InChI | InChI=1S/C20H27NO5/c1-5-21(6-2)11-12-24-18-16-14(26-20(3,4)19(18)23)9-7-13-8-10-15(22)25-17(13)16/h7-10,18-19,23H,5-6,11-12H2,1-4H3 |
| InChIKey | FPQVVZRCAYLJHS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|