C14H12O5 — CID 163062968
(10R)-10-hydroxy-8,8-dimethyl-10H-pyrano[2,3-f]chromene-2,9-dione (PubChem CID 163062968) has the molecular formula C14H12O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is (10R)-10-hydroxy-8,8-dimethyl-10H-pyrano[2,3-f]chromene-2,9-dione.
| Compound Name | (10R)-10-hydroxy-8,8-dimethyl-10H-pyrano[2,3-f]chromene-2,9-dione |
|---|---|
| PubChem CID | 163062968 |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (10R)-10-hydroxy-8,8-dimethyl-10H-pyrano[2,3-f]chromene-2,9-dione |
| SMILES | CC1(C)Oc2ccc3ccc(=O)oc3c2[C@@H](O)C1=O |
| InChI | InChI=1S/C14H12O5/c1-14(2)13(17)11(16)10-8(19-14)5-3-7-4-6-9(15)18-12(7)10/h3-6,11,16H,1-2H3/t11-/m1/s1 |
| InChIKey | MCWPEMKMGFSTFE-LLVKDONJSA-N |
| XLogP | 1.57 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|