C17H28O6 — CID 145328877
[(Z)-[(3R,4R)-3-hexanoyloxy-4-hydroxyoxolan-2-ylidene]methyl] hexanoate (PubChem CID 145328877) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is [(Z)-[(3R,4R)-3-hexanoyloxy-4-hydroxyoxolan-2-ylidene]methyl] hexanoate.
| Compound Name | [(Z)-[(3R,4R)-3-hexanoyloxy-4-hydroxyoxolan-2-ylidene]methyl] hexanoate |
|---|---|
| PubChem CID | 145328877 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [(Z)-[(3R,4R)-3-hexanoyloxy-4-hydroxyoxolan-2-ylidene]methyl] hexanoate |
| SMILES | CCCCCC(=O)O/C=C1\OC[C@@H](O)[C@H]1OC(=O)CCCCC |
| InChI | InChI=1S/C17H28O6/c1-3-5-7-9-15(19)22-12-14-17(13(18)11-21-14)23-16(20)10-8-6-4-2/h12-13,17-18H,3-11H2,1-2H3/b14-12-/t13-,17-/m1/s1 |
| InChIKey | XSNQZHISRRZZMZ-ZMPSWKENSA-N |
| XLogP | 2.83 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|