C18H30O6 — CID 156582478
[(1S,5S,6R)-5,6-dihydroxy-4-methoxy-2-oxocyclohex-3-en-1-yl] undecanoate (PubChem CID 156582478) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is [(1S,5S,6R)-5,6-dihydroxy-4-methoxy-2-oxocyclohex-3-en-1-yl] undecanoate.
| Compound Name | [(1S,5S,6R)-5,6-dihydroxy-4-methoxy-2-oxocyclohex-3-en-1-yl] undecanoate |
|---|---|
| PubChem CID | 156582478 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | [(1S,5S,6R)-5,6-dihydroxy-4-methoxy-2-oxocyclohex-3-en-1-yl] undecanoate |
| SMILES | CCCCCCCCCCC(=O)O[C@@H]1C(=O)C=C(OC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H30O6/c1-3-4-5-6-7-8-9-10-11-15(20)24-18-13(19)12-14(23-2)16(21)17(18)22/h12,16-18,21-22H,3-11H2,1-2H3/t16-,17-,18-/m1/s1 |
| InChIKey | JKQXBDVSNBTUDS-KZNAEPCWSA-N |
| XLogP | 2.26 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|