C16H28O3 — CID 137392250
[(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] hexanoate (PubChem CID 137392250) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] hexanoate.
| Compound Name | [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] hexanoate |
|---|---|
| PubChem CID | 137392250 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@H]1C[C@H](C(C)(C)O)CC=C1C |
| InChI | InChI=1S/C16H28O3/c1-5-6-7-8-15(17)19-14-11-13(16(3,4)18)10-9-12(14)2/h9,13-14,18H,5-8,10-11H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | JJDSGAXFOAUFRD-KGLIPLIRSA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|