C17H28O3 — CID 137392245
[(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (E)-4-methylhex-4-enoate (PubChem CID 137392245) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (E)-4-methylhex-4-enoate.
| Compound Name | [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (E)-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 137392245 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (E)-4-methylhex-4-enoate |
| SMILES | C/C=C(\C)CCC(=O)O[C@H]1C[C@H](C(C)(C)O)CC=C1C |
| InChI | InChI=1S/C17H28O3/c1-6-12(2)7-10-16(18)20-15-11-14(17(4,5)19)9-8-13(15)3/h6,8,14-15,19H,7,9-11H2,1-5H3/b12-6+/t14-,15+/m1/s1 |
| InChIKey | DEBLIZQXECIXBD-KOHOMEMWSA-N |
| XLogP | 3.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|