C18H22O5 — CID 44566821
methyl 4-[(1E)-2,6-dimethyl-4-oxohepta-1,5-dienoxy]-3-methoxybenzoate (PubChem CID 44566821) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is methyl 4-[(1E)-2,6-dimethyl-4-oxohepta-1,5-dienoxy]-3-methoxybenzoate.
| Compound Name | methyl 4-[(1E)-2,6-dimethyl-4-oxohepta-1,5-dienoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 44566821 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | methyl 4-[(1E)-2,6-dimethyl-4-oxohepta-1,5-dienoxy]-3-methoxybenzoate |
| SMILES | COC(=O)c1ccc(O/C=C(\C)CC(=O)C=C(C)C)c(OC)c1 |
| InChI | InChI=1S/C18H22O5/c1-12(2)8-15(19)9-13(3)11-23-16-7-6-14(18(20)22-5)10-17(16)21-4/h6-8,10-11H,9H2,1-5H3/b13-11+ |
| InChIKey | KIFOOYAEMUDTLW-ACCUITESSA-N |
| XLogP | 3.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|