C21H21NO7 — CID 51045820
dimethyl 2-[[(E)-3-(3,4-dimethoxyphenyl)-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate (PubChem CID 51045820) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is dimethyl 2-[[(E)-3-(3,4-dimethoxyphenyl)-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[(E)-3-(3,4-dimethoxyphenyl)-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 51045820 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | dimethyl 2-[[(E)-3-(3,4-dimethoxyphenyl)-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(N/C=C/C(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C21H21NO7/c1-26-18-8-6-13(12-19(18)27-2)17(23)9-10-22-16-11-14(20(24)28-3)5-7-15(16)21(25)29-4/h5-12,22H,1-4H3/b10-9+ |
| InChIKey | YRRZESFKXBKHFZ-MDZDMXLPSA-N |
| XLogP | 3.09 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|