C21H21NO6 — CID 46858592
dimethyl 2-[[(E)-3-(4-ethoxyphenyl)-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate (PubChem CID 46858592) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is dimethyl 2-[[(E)-3-(4-ethoxyphenyl)-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[(E)-3-(4-ethoxyphenyl)-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 46858592 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | dimethyl 2-[[(E)-3-(4-ethoxyphenyl)-3-oxoprop-1-enyl]amino]benzene-1,4-dicarboxylate |
| SMILES | CCOc1ccc(C(=O)/C=C/Nc2cc(C(=O)OC)ccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C21H21NO6/c1-4-28-16-8-5-14(6-9-16)19(23)11-12-22-18-13-15(20(24)26-2)7-10-17(18)21(25)27-3/h5-13,22H,4H2,1-3H3/b12-11+ |
| InChIKey | VCVJLCXVEQZYCT-VAWYXSNFSA-N |
| XLogP | 3.47 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|