C26H38O6 — CID 44567144
[(1S,3S,5S,8S,10S,14S)-10,14-diacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate (PubChem CID 44567144) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is [(1S,3S,5S,8S,10S,14S)-10,14-diacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate.
| Compound Name | [(1S,3S,5S,8S,10S,14S)-10,14-diacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
|---|---|
| PubChem CID | 44567144 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | [(1S,3S,5S,8S,10S,14S)-10,14-diacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
| SMILES | C=C1[C@@H](OC(C)=O)CC[C@@]2(C)C[C@H](OC(C)=O)C3=C(C)C[C@H](OC(C)=O)[C@@H](C[C@H]12)C3(C)C |
| InChI | InChI=1S/C26H38O6/c1-14-11-22(31-17(4)28)20-12-19-15(2)21(30-16(3)27)9-10-26(19,8)13-23(32-18(5)29)24(14)25(20,6)7/h19-23H,2,9-13H2,1,3-8H3/t19-,20-,21+,22+,23+,26+/m1/s1 |
| InChIKey | IZZSSHPUMGSXRG-RECADABPSA-N |
| XLogP | 4.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|