C20H28O3 — CID 44567221
(1R,3R,5E,12R,15R)-5,12-dimethyl-9-methylidene-15-propan-2-yl-2-oxatricyclo[10.3.0.01,3]pentadec-5-ene-10,14-dione (PubChem CID 44567221) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1R,3R,5E,12R,15R)-5,12-dimethyl-9-methylidene-15-propan-2-yl-2-oxatricyclo[10.3.0.01,3]pentadec-5-ene-10,14-dione.
| Compound Name | (1R,3R,5E,12R,15R)-5,12-dimethyl-9-methylidene-15-propan-2-yl-2-oxatricyclo[10.3.0.01,3]pentadec-5-ene-10,14-dione |
|---|---|
| PubChem CID | 44567221 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1R,3R,5E,12R,15R)-5,12-dimethyl-9-methylidene-15-propan-2-yl-2-oxatricyclo[10.3.0.01,3]pentadec-5-ene-10,14-dione |
| SMILES | C=C1CC/C=C(\C)C[C@H]2O[C@@]23[C@@H](C(C)C)C(=O)C[C@]3(C)CC1=O |
| InChI | InChI=1S/C20H28O3/c1-12(2)18-16(22)11-19(5)10-15(21)14(4)8-6-7-13(3)9-17-20(18,19)23-17/h7,12,17-18H,4,6,8-11H2,1-3,5H3/b13-7+/t17-,18+,19+,20-/m1/s1 |
| InChIKey | GBQBSZHGWQDJFQ-DOKOQSFGSA-N |
| XLogP | 4.02 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|