C24H33NO4 — CID 44567773
(1S,2S,4R,7E,11S,12R)-12-[[2-(3-methoxyphenyl)ethylamino]methyl]-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one (PubChem CID 44567773) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is (1S,2S,4R,7E,11S,12R)-12-[[2-(3-methoxyphenyl)ethylamino]methyl]-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one.
| Compound Name | (1S,2S,4R,7E,11S,12R)-12-[[2-(3-methoxyphenyl)ethylamino]methyl]-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
|---|---|
| PubChem CID | 44567773 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | (1S,2S,4R,7E,11S,12R)-12-[[2-(3-methoxyphenyl)ethylamino]methyl]-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
| SMILES | COc1cccc(CCNC[C@@H]2C(=O)O[C@H]3[C@H]2CC/C(C)=C/CC[C@@]2(C)O[C@@H]32)c1 |
| InChI | InChI=1S/C24H33NO4/c1-16-6-5-12-24(2)22(29-24)21-19(10-9-16)20(23(26)28-21)15-25-13-11-17-7-4-8-18(14-17)27-3/h4,6-8,14,19-22,25H,5,9-13,15H2,1-3H3/b16-6+/t19-,20-,21-,22-,24+/m0/s1 |
| InChIKey | WMGKBSKCYNDONW-UUMHMROZSA-N |
| XLogP | 3.66 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|