C29H33N3O4 — CID 44567833
4-[[4-[methyl-[2-oxo-2-(4-phenoxyanilino)ethyl]amino]azepan-1-yl]methyl]benzoic acid (PubChem CID 44567833) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is 4-[[4-[methyl-[2-oxo-2-(4-phenoxyanilino)ethyl]amino]azepan-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[4-[methyl-[2-oxo-2-(4-phenoxyanilino)ethyl]amino]azepan-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 44567833 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 4-[[4-[methyl-[2-oxo-2-(4-phenoxyanilino)ethyl]amino]azepan-1-yl]methyl]benzoic acid |
| SMILES | CN(CC(=O)Nc1ccc(Oc2ccccc2)cc1)C1CCCN(Cc2ccc(C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C29H33N3O4/c1-31(21-28(33)30-24-13-15-27(16-14-24)36-26-7-3-2-4-8-26)25-6-5-18-32(19-17-25)20-22-9-11-23(12-10-22)29(34)35/h2-4,7-16,25H,5-6,17-21H2,1H3,(H,30,33)(H,34,35) |
| InChIKey | SCUPHOKPNXPNLB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |