C27H29N3O4 — CID 69399999
4-[[3-methyl-4-[2-oxo-2-(4-phenoxyanilino)ethyl]piperazin-1-yl]methyl]benzoic acid (PubChem CID 69399999) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-[[3-methyl-4-[2-oxo-2-(4-phenoxyanilino)ethyl]piperazin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[3-methyl-4-[2-oxo-2-(4-phenoxyanilino)ethyl]piperazin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 69399999 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 4-[[3-methyl-4-[2-oxo-2-(4-phenoxyanilino)ethyl]piperazin-1-yl]methyl]benzoic acid |
| SMILES | CC1CN(Cc2ccc(C(=O)O)cc2)CCN1CC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N3O4/c1-20-17-29(18-21-7-9-22(10-8-21)27(32)33)15-16-30(20)19-26(31)28-23-11-13-25(14-12-23)34-24-5-3-2-4-6-24/h2-14,20H,15-19H2,1H3,(H,28,31)(H,32,33) |
| InChIKey | NCCBGKZJKQIFGC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |