C27H28IN3O4 — CID 69400574
4-[[2-iodo-1-[2-oxo-2-(4-phenoxyanilino)ethyl]piperidin-4-yl]-methylamino]benzoic acid (PubChem CID 69400574) has the molecular formula C27H28IN3O4 and a molecular weight of 585.44 g/mol. Its IUPAC name is 4-[[2-iodo-1-[2-oxo-2-(4-phenoxyanilino)ethyl]piperidin-4-yl]-methylamino]benzoic acid.
| Compound Name | 4-[[2-iodo-1-[2-oxo-2-(4-phenoxyanilino)ethyl]piperidin-4-yl]-methylamino]benzoic acid |
|---|---|
| PubChem CID | 69400574 |
| Molecular Formula | C27H28IN3O4 |
| Molecular Weight | 585.44 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | 4-[[2-iodo-1-[2-oxo-2-(4-phenoxyanilino)ethyl]piperidin-4-yl]-methylamino]benzoic acid |
| SMILES | CN(c1ccc(C(=O)O)cc1)C1CCN(CC(=O)Nc2ccc(Oc3ccccc3)cc2)C(I)C1 |
| InChI | InChI=1S/C27H28IN3O4/c1-30(21-11-7-19(8-12-21)27(33)34)22-15-16-31(25(28)17-22)18-26(32)29-20-9-13-24(14-10-20)35-23-5-3-2-4-6-23/h2-14,22,25H,15-18H2,1H3,(H,29,32)(H,33,34) |
| InChIKey | BRSBJBLBCJFLBH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|