C26H27IN2O3 — CID 69153452
4-[[[2-iodo-1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]amino]methyl]benzoic acid (PubChem CID 69153452) has the molecular formula C26H27IN2O3 and a molecular weight of 542.42 g/mol. Its IUPAC name is 4-[[[2-iodo-1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-iodo-1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 69153452 |
| Molecular Formula | C26H27IN2O3 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | 4-[[[2-iodo-1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC2CCN(Cc3ccc(Oc4ccccc4)cc3)C(I)C2)cc1 |
| InChI | InChI=1S/C26H27IN2O3/c27-25-16-22(28-17-19-6-10-21(11-7-19)26(30)31)14-15-29(25)18-20-8-12-24(13-9-20)32-23-4-2-1-3-5-23/h1-13,22,25,28H,14-18H2,(H,30,31) |
| InChIKey | FRXFZGANENUONZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|