C25H34N4O3 — CID 44568072
(2R)-N,N-diethyl-2-[(2R,5S)-5-[(2R)-2-[4-[2-(4-methoxyphenyl)ethynyl]triazol-1-yl]propyl]oxolan-2-yl]propanamide (PubChem CID 44568072) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is (2R)-N,N-diethyl-2-[(2R,5S)-5-[(2R)-2-[4-[2-(4-methoxyphenyl)ethynyl]triazol-1-yl]propyl]oxolan-2-yl]propanamide.
| Compound Name | (2R)-N,N-diethyl-2-[(2R,5S)-5-[(2R)-2-[4-[2-(4-methoxyphenyl)ethynyl]triazol-1-yl]propyl]oxolan-2-yl]propanamide |
|---|---|
| PubChem CID | 44568072 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | (2R)-N,N-diethyl-2-[(2R,5S)-5-[(2R)-2-[4-[2-(4-methoxyphenyl)ethynyl]triazol-1-yl]propyl]oxolan-2-yl]propanamide |
| SMILES | CCN(CC)C(=O)[C@H](C)[C@H]1CC[C@@H](C[C@@H](C)n2cc(C#Cc3ccc(OC)cc3)nn2)O1 |
| InChI | InChI=1S/C25H34N4O3/c1-6-28(7-2)25(30)19(4)24-15-14-23(32-24)16-18(3)29-17-21(26-27-29)11-8-20-9-12-22(31-5)13-10-20/h9-10,12-13,17-19,23-24H,6-7,14-16H2,1-5H3/t18-,19-,23+,24-/m1/s1 |
| InChIKey | XILVWMBDVHHDIH-PBIIQAGSSA-N |
| XLogP | 3.69 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|