C20H23N5O3 — CID 44569142
6-amino-7-[2-[ethyl(pyridin-2-yl)amino]ethylamino]-1-methyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 44569142) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 6-amino-7-[2-[ethyl(pyridin-2-yl)amino]ethylamino]-1-methyl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 6-amino-7-[2-[ethyl(pyridin-2-yl)amino]ethylamino]-1-methyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 44569142 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 6-amino-7-[2-[ethyl(pyridin-2-yl)amino]ethylamino]-1-methyl-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCN(CCNc1cc2c(cc1N)c(=O)c(C(=O)O)cn2C)c1ccccn1 |
| InChI | InChI=1S/C20H23N5O3/c1-3-25(18-6-4-5-7-23-18)9-8-22-16-11-17-13(10-15(16)21)19(26)14(20(27)28)12-24(17)2/h4-7,10-12,22H,3,8-9,21H2,1-2H3,(H,27,28) |
| InChIKey | LKFWOZMGAJGVBT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|