C23H20N4O3 — CID 44569629
(1'S,3S,12'R)-12'-propan-2-ylspiro[1H-indole-3,16'-2,10,13-triazatetracyclo[10.2.2.02,11.04,9]hexadeca-4,6,8,10-tetraene]-2,3',14'-trione (PubChem CID 44569629) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is (1'S,3S,12'R)-12'-propan-2-ylspiro[1H-indole-3,16'-2,10,13-triazatetracyclo[10.2.2.02,11.04,9]hexadeca-4,6,8,10-tetraene]-2,3',14'-trione.
| Compound Name | (1'S,3S,12'R)-12'-propan-2-ylspiro[1H-indole-3,16'-2,10,13-triazatetracyclo[10.2.2.02,11.04,9]hexadeca-4,6,8,10-tetraene]-2,3',14'-trione |
|---|---|
| PubChem CID | 44569629 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (1'S,3S,12'R)-12'-propan-2-ylspiro[1H-indole-3,16'-2,10,13-triazatetracyclo[10.2.2.02,11.04,9]hexadeca-4,6,8,10-tetraene]-2,3',14'-trione |
| SMILES | CC(C)[C@@]12NC(=O)[C@H](C[C@@]13C(=O)Nc1ccccc13)n1c2nc2ccccc2c1=O |
| InChI | InChI=1S/C23H20N4O3/c1-12(2)23-20-24-15-9-5-3-7-13(15)19(29)27(20)17(18(28)26-23)11-22(23)14-8-4-6-10-16(14)25-21(22)30/h3-10,12,17H,11H2,1-2H3,(H,25,30)(H,26,28)/t17-,22+,23-/m0/s1 |
| InChIKey | PFHJNLITOLAUAX-IMRHEYAYSA-N |
| XLogP | 2.21 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |