C22H20ClN5O — CID 44570653
1-(4-chlorophenyl)-9-phenyl-2-piperidin-1-ylpurin-6-one (PubChem CID 44570653) has the molecular formula C22H20ClN5O and a molecular weight of 405.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-9-phenyl-2-piperidin-1-ylpurin-6-one.
| Compound Name | 1-(4-chlorophenyl)-9-phenyl-2-piperidin-1-ylpurin-6-one |
|---|---|
| PubChem CID | 44570653 |
| Molecular Formula | C22H20ClN5O |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1-(4-chlorophenyl)-9-phenyl-2-piperidin-1-ylpurin-6-one |
| SMILES | O=c1c2ncn(-c3ccccc3)c2nc(N2CCCCC2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClN5O/c23-16-9-11-18(12-10-16)28-21(29)19-20(25-22(28)26-13-5-2-6-14-26)27(15-24-19)17-7-3-1-4-8-17/h1,3-4,7-12,15H,2,5-6,13-14H2 |
| InChIKey | CMAKPPYGBXWAOJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |