C21H18N6OS — CID 44570893
N-(2-aminophenyl)-4-[[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]methyl]benzamide (PubChem CID 44570893) has the molecular formula C21H18N6OS and a molecular weight of 402.48 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 44570893 |
| Molecular Formula | C21H18N6OS |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNc2nccc(-c3nccs3)n2)cc1 |
| InChI | InChI=1S/C21H18N6OS/c22-16-3-1-2-4-17(16)26-19(28)15-7-5-14(6-8-15)13-25-21-24-10-9-18(27-21)20-23-11-12-29-20/h1-12H,13,22H2,(H,26,28)(H,24,25,27) |
| InChIKey | LXFJTNPLHVCZFR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|