C24H27Cl2N5O2 — CID 44571191
4-(2,3-dichloroanilino)-7-ethoxy-6-(4-ethylpiperazin-1-yl)quinoline-3-carboxamide (PubChem CID 44571191) has the molecular formula C24H27Cl2N5O2 and a molecular weight of 488.42 g/mol. Its IUPAC name is 4-(2,3-dichloroanilino)-7-ethoxy-6-(4-ethylpiperazin-1-yl)quinoline-3-carboxamide.
| Compound Name | 4-(2,3-dichloroanilino)-7-ethoxy-6-(4-ethylpiperazin-1-yl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 44571191 |
| Molecular Formula | C24H27Cl2N5O2 |
| Molecular Weight | 488.42 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 4-(2,3-dichloroanilino)-7-ethoxy-6-(4-ethylpiperazin-1-yl)quinoline-3-carboxamide |
| SMILES | CCOc1cc2ncc(C(N)=O)c(Nc3cccc(Cl)c3Cl)c2cc1N1CCN(CC)CC1 |
| InChI | InChI=1S/C24H27Cl2N5O2/c1-3-30-8-10-31(11-9-30)20-12-15-19(13-21(20)33-4-2)28-14-16(24(27)32)23(15)29-18-7-5-6-17(25)22(18)26/h5-7,12-14H,3-4,8-11H2,1-2H3,(H2,27,32)(H,28,29) |
| InChIKey | NTOWRHQJSNSGLV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |