About 6-bromo-4-(2,3-difluoroanilino)-7-ethoxyquinoline-3-carboxamide
6-bromo-4-(2,3-difluoroanilino)-7-ethoxyquinoline-3-carboxamide (PubChem CID 68905534) has the molecular formula C18H14BrF2N3O2
and a molecular weight of 422.23 g/mol. Its IUPAC name is 6-bromo-4-(2,3-difluoroanilino)-7-ethoxyquinoline-3-carboxamide.
Molecular Properties
| Compound Name | 6-bromo-4-(2,3-difluoroanilino)-7-ethoxyquinoline-3-carboxamide |
| PubChem CID | 68905534 |
| Molecular Formula | C18H14BrF2N3O2 |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 6-bromo-4-(2,3-difluoroanilino)-7-ethoxyquinoline-3-carboxamide |
| SMILES | CCOc1cc2ncc(C(N)=O)c(Nc3cccc(F)c3F)c2cc1Br |
| InChI | InChI=1S/C18H14BrF2N3O2/c1-2-26-15-7-14-9(6-11(15)19)17(10(8-23-14)18(22)25)24-13-5-3-4-12(20)16(13)21/h3-8H,2H2,1H3,(H2,22,25)(H,23,24) |
| InChIKey | JBPROAFBSOSOIZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-4-(2,3-difluoroanilino)-7-ethoxyquinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-(2,3-difluoroanilino)-7-ethoxyquinoline-3-carboxamide?
The IUPAC name of 6-bromo-4-(2,3-difluoroanilino)-7-ethoxyquinoline-3-carboxamide (CID 68905534) is 6-bromo-4-(2,3-difluoroanilino)-7-ethoxyquinoline-3-carboxamide.
What is the SMILES notation for 6-bromo-4-(2,3-difluoroanilino)-7-ethoxyquinoline-3-carboxamide?
The canonical SMILES for 6-bromo-4-(2,3-difluoroanilino)-7-ethoxyquinoline-3-carboxamide is CCOc1cc2ncc(C(N)=O)c(Nc3cccc(F)c3F)c2cc1Br.
What is the InChIKey of 6-bromo-4-(2,3-difluoroanilino)-7-ethoxyquinoline-3-carboxamide?
The InChIKey is JBPROAFBSOSOIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BrF2N3O2/c1-2-26-15-7-14-9(6-11(15)19)17(10(8-23-14)18(22)25)24-13-5-3-4-12(20)16(13)21/h3-8H,2H2,1H3,(H2,22,25)(H,23,24).
What are the key properties of 6-bromo-4-(2,3-difluoroanilino)-7-ethoxyquinoline-3-carboxamide?
6-bromo-4-(2,3-difluoroanilino)-7-ethoxyquinoline-3-carboxamide has a molecular weight of 422.23 g/mol, XLogP of 4.52, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-(2,3-difluoroanilino)-7-ethoxyquinoline-3-carboxamide is sourced from PubChem (CID 68905534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).