C22H25N7O3 — CID 174510827
4-[2-(aminomethyl)-3-(azidomethyl)anilino]-6,7-diethoxyquinoline-3-carboxamide (PubChem CID 174510827) has the molecular formula C22H25N7O3 and a molecular weight of 435.49 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-3-(azidomethyl)anilino]-6,7-diethoxyquinoline-3-carboxamide.
| Compound Name | 4-[2-(aminomethyl)-3-(azidomethyl)anilino]-6,7-diethoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 174510827 |
| Molecular Formula | C22H25N7O3 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 4-[2-(aminomethyl)-3-(azidomethyl)anilino]-6,7-diethoxyquinoline-3-carboxamide |
| SMILES | CCOc1cc2ncc(C(N)=O)c(Nc3cccc(CN=[N+]=[N-])c3CN)c2cc1OCC |
| InChI | InChI=1S/C22H25N7O3/c1-3-31-19-8-14-18(9-20(19)32-4-2)26-12-16(22(24)30)21(14)28-17-7-5-6-13(11-27-29-25)15(17)10-23/h5-9,12H,3-4,10-11,23H2,1-2H3,(H2,24,30)(H,26,28) |
| InChIKey | DGXWOZBSRXCFJJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 161.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|