C33H41F6N5O8 — CID 87747825
4-[3-[[[(2S,3S)-2-amino-3-methylpentanoyl]amino]methyl]-2-ethylanilino]-6,7-diethoxyquinoline-3-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87747825) has the molecular formula C33H41F6N5O8 and a molecular weight of 749.71 g/mol. Its IUPAC name is 4-[3-[[[(2S,3S)-2-amino-3-methylpentanoyl]amino]methyl]-2-ethylanilino]-6,7-diethoxyquinoline-3-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[3-[[[(2S,3S)-2-amino-3-methylpentanoyl]amino]methyl]-2-ethylanilino]-6,7-diethoxyquinoline-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87747825 |
| Molecular Formula | C33H41F6N5O8 |
| Molecular Weight | 749.71 g/mol |
| Exact Mass | 749.29 |
| IUPAC Name | 4-[3-[[[(2S,3S)-2-amino-3-methylpentanoyl]amino]methyl]-2-ethylanilino]-6,7-diethoxyquinoline-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCOc1cc2ncc(C(N)=O)c(Nc3cccc(CNC(=O)[C@@H](N)[C@@H](C)CC)c3CC)c2cc1OCC.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H39N5O4.2C2HF3O2/c1-6-17(5)26(30)29(36)33-15-18-11-10-12-22(19(18)7-2)34-27-20-13-24(37-8-3)25(38-9-4)14-23(20)32-16-21(27)28(31)35;2*3-2(4,5)1(6)7/h10-14,16-17,26H,6-9,15,30H2,1-5H3,(H2,31,35)(H,32,34)(H,33,36);2*(H,6,7)/t17-,26-;;/m0../s1 |
| InChIKey | RVFOQHUXSDVZKV-AHZDVITESA-N |
| XLogP | 5.69 |
| TPSA | 216.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.71 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |