C36H36F6N4O7 — CID 87748050
[(2S,3S)-2-[[3-[(3-carbamoyl-6,7-diethoxyquinolin-4-yl)amino]-2-ethylphenyl]methylamino]-3-phenyl-3-(2,2,2-trifluoroacetyl)oxypropyl] 2,2,2-trifluoroacetate (PubChem CID 87748050) has the molecular formula C36H36F6N4O7 and a molecular weight of 750.69 g/mol. Its IUPAC name is [(2S,3S)-2-[[3-[(3-carbamoyl-6,7-diethoxyquinolin-4-yl)amino]-2-ethylphenyl]methylamino]-3-phenyl-3-(2,2,2-trifluoroacetyl)oxypropyl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S,3S)-2-[[3-[(3-carbamoyl-6,7-diethoxyquinolin-4-yl)amino]-2-ethylphenyl]methylamino]-3-phenyl-3-(2,2,2-trifluoroacetyl)oxypropyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87748050 |
| Molecular Formula | C36H36F6N4O7 |
| Molecular Weight | 750.69 g/mol |
| Exact Mass | 750.25 |
| IUPAC Name | [(2S,3S)-2-[[3-[(3-carbamoyl-6,7-diethoxyquinolin-4-yl)amino]-2-ethylphenyl]methylamino]-3-phenyl-3-(2,2,2-trifluoroacetyl)oxypropyl] 2,2,2-trifluoroacetate |
| SMILES | CCOc1cc2ncc(C(N)=O)c(Nc3cccc(CN[C@@H](COC(=O)C(F)(F)F)[C@@H](OC(=O)C(F)(F)F)c4ccccc4)c3CC)c2cc1OCC |
| InChI | InChI=1S/C36H36F6N4O7/c1-4-22-21(17-44-27(19-52-33(48)35(37,38)39)31(20-11-8-7-9-12-20)53-34(49)36(40,41)42)13-10-14-25(22)46-30-23-15-28(50-5-2)29(51-6-3)16-26(23)45-18-24(30)32(43)47/h7-16,18,27,31,44H,4-6,17,19H2,1-3H3,(H2,43,47)(H,45,46)/t27-,31-/m0/s1 |
| InChIKey | PUKGBOSZMJCLJB-DHIFEGFHSA-N |
| XLogP | 6.85 |
| TPSA | 151.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.69 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |