C22H31N5O4 — CID 44571513
5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N-methyl-N-(pyridin-2-ylmethyl)-1,2,4-oxadiazole-3-carboxamide (PubChem CID 44571513) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N-methyl-N-(pyridin-2-ylmethyl)-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N-methyl-N-(pyridin-2-ylmethyl)-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 44571513 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N-methyl-N-(pyridin-2-ylmethyl)-1,2,4-oxadiazole-3-carboxamide |
| SMILES | CN(Cc1ccccn1)C(=O)c1noc([C@H](CCCC2CCCCC2)CC(=O)NO)n1 |
| InChI | InChI=1S/C22H31N5O4/c1-27(15-18-12-5-6-13-23-18)22(29)20-24-21(31-26-20)17(14-19(28)25-30)11-7-10-16-8-3-2-4-9-16/h5-6,12-13,16-17,30H,2-4,7-11,14-15H2,1H3,(H,25,28)/t17-/m1/s1 |
| InChIKey | OFLBRKJKSKQKCC-QGZVFWFLSA-N |
| XLogP | 3.47 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|