C18H25N5O5S2 — CID 44572289
(S)-ethyl 1-oxo-1-(4-phenylthiazol-2-ylamino)-6-(sulfamoylamino)hexan-2-ylcarbamate (PubChem CID 44572289) has the molecular formula C18H25N5O5S2 and a molecular weight of 455.60 g/mol. Its IUPAC name is ethyl N-[(2S)-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]-6-(sulfamoylamino)hexan-2-yl]carbamate.
| Compound Name | (S)-ethyl 1-oxo-1-(4-phenylthiazol-2-ylamino)-6-(sulfamoylamino)hexan-2-ylcarbamate |
|---|---|
| PubChem CID | 44572289 |
| Molecular Formula | C18H25N5O5S2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | ethyl N-[(2S)-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]-6-(sulfamoylamino)hexan-2-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H](CCCCNS(=O)(=O)N)C(=O)NC1=NC(=CS1)C2=CC=CC=C2 |
| InChI | InChI=1S/C18H25N5O5S2/c1-2-28-18(25)22-14(10-6-7-11-20-30(19,26)27)16(24)23-17-21-15(12-29-17)13-8-4-3-5-9-13/h3-5,8-9,12,14,20H,2,6-7,10-11H2,1H3,(H,22,25)(H2,19,26,27)(H,21,23,24)/t14-/m0/s1 |
| InChIKey | CRZWRKQPQRSBOI-AWEZNQCLSA-N |
| XLogP | 1.80 |
| TPSA | 189.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | 652 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|