C28H23N7O2S — CID 44572430
2-N-(2-aminophenyl)-5-N-[4-methyl-3-[(5-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]thiophene-2,5-dicarboxamide (PubChem CID 44572430) has the molecular formula C28H23N7O2S and a molecular weight of 521.61 g/mol. Its IUPAC name is 2-N-(2-aminophenyl)-5-N-[4-methyl-3-[(5-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]thiophene-2,5-dicarboxamide.
| Compound Name | 2-N-(2-aminophenyl)-5-N-[4-methyl-3-[(5-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 44572430 |
| Molecular Formula | C28H23N7O2S |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 2-N-(2-aminophenyl)-5-N-[4-methyl-3-[(5-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]thiophene-2,5-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(C(=O)Nc3ccccc3N)s2)cc1Nc1ncc(-c2cccnc2)cn1 |
| InChI | InChI=1S/C28H23N7O2S/c1-17-8-9-20(13-23(17)35-28-31-15-19(16-32-28)18-5-4-12-30-14-18)33-26(36)24-10-11-25(38-24)27(37)34-22-7-3-2-6-21(22)29/h2-16H,29H2,1H3,(H,33,36)(H,34,37)(H,31,32,35) |
| InChIKey | WSOUPZRFRJNSQF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|