C14H17NO4S — CID 44573126
methyl (2S,4S,5S)-4-ethenylsulfonyl-5-phenylpyrrolidine-2-carboxylate (PubChem CID 44573126) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is methyl (2S,4S,5S)-4-ethenylsulfonyl-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S,5S)-4-ethenylsulfonyl-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 44573126 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | methyl (2S,4S,5S)-4-ethenylsulfonyl-5-phenylpyrrolidine-2-carboxylate |
| SMILES | C=CS(=O)(=O)[C@H]1C[C@@H](C(=O)OC)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H17NO4S/c1-3-20(17,18)12-9-11(14(16)19-2)15-13(12)10-7-5-4-6-8-10/h3-8,11-13,15H,1,9H2,2H3/t11-,12-,13-/m0/s1 |
| InChIKey | ZJPNBGWHCIIJEZ-AVGNSLFASA-N |
| XLogP | 1.19 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |