C13H16N4O — CID 44573562
5-(2-propan-2-ylphenoxy)pyrimidine-2,4-diamine (PubChem CID 44573562) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 5-(2-propan-2-ylphenoxy)pyrimidine-2,4-diamine.
| Compound Name | 5-(2-propan-2-ylphenoxy)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 44573562 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 5-(2-propan-2-ylphenoxy)pyrimidine-2,4-diamine |
| SMILES | CC(C)c1ccccc1Oc1cnc(N)nc1N |
| InChI | InChI=1S/C13H16N4O/c1-8(2)9-5-3-4-6-10(9)18-11-7-16-13(15)17-12(11)14/h3-8H,1-2H3,(H4,14,15,16,17) |
| InChIKey | YILCHFFZMXESIM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |