C17H23IN4O4 — CID 24883277
2-[[4-amino-5-(5-iodo-4-methoxy-2-propan-2-ylphenoxy)pyrimidin-2-yl]amino]propane-1,3-diol (PubChem CID 24883277) has the molecular formula C17H23IN4O4 and a molecular weight of 474.30 g/mol. Its IUPAC name is 2-[[4-amino-5-(5-iodo-4-methoxy-2-propan-2-ylphenoxy)pyrimidin-2-yl]amino]propane-1,3-diol.
| Compound Name | 2-[[4-amino-5-(5-iodo-4-methoxy-2-propan-2-ylphenoxy)pyrimidin-2-yl]amino]propane-1,3-diol |
|---|---|
| PubChem CID | 24883277 |
| Molecular Formula | C17H23IN4O4 |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 2-[[4-amino-5-(5-iodo-4-methoxy-2-propan-2-ylphenoxy)pyrimidin-2-yl]amino]propane-1,3-diol |
| SMILES | COc1cc(C(C)C)c(Oc2cnc(NC(CO)CO)nc2N)cc1I |
| InChI | InChI=1S/C17H23IN4O4/c1-9(2)11-4-14(25-3)12(18)5-13(11)26-15-6-20-17(22-16(15)19)21-10(7-23)8-24/h4-6,9-10,23-24H,7-8H2,1-3H3,(H3,19,20,21,22) |
| InChIKey | PAYROHWFGZADBR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|