C18H18N4O4S — CID 44574139
N-hydroxy-5-[5-oxo-5-[(4-phenyl-1,3-thiazol-2-yl)amino]pentyl]-1,2-oxazole-3-carboxamide (PubChem CID 44574139) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is N-hydroxy-5-[5-oxo-5-[(4-phenyl-1,3-thiazol-2-yl)amino]pentyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-hydroxy-5-[5-oxo-5-[(4-phenyl-1,3-thiazol-2-yl)amino]pentyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 44574139 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-hydroxy-5-[5-oxo-5-[(4-phenyl-1,3-thiazol-2-yl)amino]pentyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(CCCCc1cc(C(=O)NO)no1)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H18N4O4S/c23-16(9-5-4-8-13-10-14(22-26-13)17(24)21-25)20-18-19-15(11-27-18)12-6-2-1-3-7-12/h1-3,6-7,10-11,25H,4-5,8-9H2,(H,21,24)(H,19,20,23) |
| InChIKey | VETFNWHZDHZTFS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|