C30H32Cl2N2O2 — CID 44574962
8-[bis(2-chlorophenyl)methyl]-N-(2-methoxyethyl)-3-phenyl-8-azabicyclo[3.2.1]octane-3-carboxamide (PubChem CID 44574962) has the molecular formula C30H32Cl2N2O2 and a molecular weight of 523.50 g/mol. Its IUPAC name is 8-[bis(2-chlorophenyl)methyl]-N-(2-methoxyethyl)-3-phenyl-8-azabicyclo[3.2.1]octane-3-carboxamide.
| Compound Name | 8-[bis(2-chlorophenyl)methyl]-N-(2-methoxyethyl)-3-phenyl-8-azabicyclo[3.2.1]octane-3-carboxamide |
|---|---|
| PubChem CID | 44574962 |
| Molecular Formula | C30H32Cl2N2O2 |
| Molecular Weight | 523.50 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 8-[bis(2-chlorophenyl)methyl]-N-(2-methoxyethyl)-3-phenyl-8-azabicyclo[3.2.1]octane-3-carboxamide |
| SMILES | COCCNC(=O)C1(c2ccccc2)CC2CCC(C1)N2C(c1ccccc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C30H32Cl2N2O2/c1-36-18-17-33-29(35)30(21-9-3-2-4-10-21)19-22-15-16-23(20-30)34(22)28(24-11-5-7-13-26(24)31)25-12-6-8-14-27(25)32/h2-14,22-23,28H,15-20H2,1H3,(H,33,35) |
| InChIKey | RYSIREMKKVFZGH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|