C18H20O10 — CID 44575428
methyl 1,5-dihydroxy-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalene-2-carboxylate (PubChem CID 44575428) has the molecular formula C18H20O10 and a molecular weight of 396.35 g/mol. Its IUPAC name is methyl 1,5-dihydroxy-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalene-2-carboxylate.
| Compound Name | methyl 1,5-dihydroxy-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 44575428 |
| Molecular Formula | C18H20O10 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | methyl 1,5-dihydroxy-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc(O[C@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2O)c2c(O)cccc2c1O |
| InChI | InChI=1S/C18H20O10/c1-26-17(25)8-5-10(12-7(13(8)21)3-2-4-9(12)20)27-18-16(24)15(23)14(22)11(6-19)28-18/h2-5,11,14-16,18-24H,6H2,1H3/t11-,14-,15+,16-,18-/m0/s1 |
| InChIKey | CLBNGMZCLWXWIT-PUCCSIKASA-N |
| XLogP | -0.78 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |