C16H25FO5 — CID 44576372
(1S,4S,5R,8R,9R,10R,12R,13R)-9-fluoro-10-methoxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 44576372) has the molecular formula C16H25FO5 and a molecular weight of 316.37 g/mol. Its IUPAC name is (1S,4S,5R,8R,9R,10R,12R,13R)-9-fluoro-10-methoxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1S,4S,5R,8R,9R,10R,12R,13R)-9-fluoro-10-methoxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 44576372 |
| Molecular Formula | C16H25FO5 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (1S,4S,5R,8R,9R,10R,12R,13R)-9-fluoro-10-methoxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | CO[C@@H]1O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@@]1(C)F)[C@@]24OO3 |
| InChI | InChI=1S/C16H25FO5/c1-9-5-6-11-15(3,17)12(18-4)19-13-16(11)10(9)7-8-14(2,20-13)21-22-16/h9-13H,5-8H2,1-4H3/t9-,10+,11+,12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | GMQPMNXBVFIFOX-YRDUFCKGSA-N |
| XLogP | 2.93 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|