About 2-butoxy-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine
2-butoxy-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine (PubChem CID 44578648) has the molecular formula C17H19F2N5O
and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-butoxy-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine.
Molecular Properties
| Compound Name | 2-butoxy-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine |
| PubChem CID | 44578648 |
| Molecular Formula | C17H19F2N5O |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-butoxy-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine |
| SMILES | CCCCOc1nc(N)c2ncn(Cc3c(F)ccc(C)c3F)c2n1 |
| InChI | InChI=1S/C17H19F2N5O/c1-3-4-7-25-17-22-15(20)14-16(23-17)24(9-21-14)8-11-12(18)6-5-10(2)13(11)19/h5-6,9H,3-4,7-8H2,1-2H3,(H2,20,22,23) |
| InChIKey | VKAFWYFTZZHVKE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine?
The IUPAC name of 2-butoxy-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine (CID 44578648) is 2-butoxy-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine.
What is the SMILES notation for 2-butoxy-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine?
The canonical SMILES for 2-butoxy-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine is CCCCOc1nc(N)c2ncn(Cc3c(F)ccc(C)c3F)c2n1.
What is the InChIKey of 2-butoxy-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine?
The InChIKey is VKAFWYFTZZHVKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F2N5O/c1-3-4-7-25-17-22-15(20)14-16(23-17)24(9-21-14)8-11-12(18)6-5-10(2)13(11)19/h5-6,9H,3-4,7-8H2,1-2H3,(H2,20,22,23).
What are the key properties of 2-butoxy-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine?
2-butoxy-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine has a molecular weight of 347.37 g/mol, XLogP of 3.22, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-9-[(2,6-difluoro-3-methylphenyl)methyl]purin-6-amine is sourced from PubChem (CID 44578648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).