C16H17F2N5O2 — CID 44578773
6-amino-2-butoxy-9-[(2,6-difluorophenyl)methyl]-7H-purin-8-one (PubChem CID 44578773) has the molecular formula C16H17F2N5O2 and a molecular weight of 349.34 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[(2,6-difluorophenyl)methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[(2,6-difluorophenyl)methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 44578773 |
| Molecular Formula | C16H17F2N5O2 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 6-amino-2-butoxy-9-[(2,6-difluorophenyl)methyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3c(F)cccc3F)c2n1 |
| InChI | InChI=1S/C16H17F2N5O2/c1-2-3-7-25-15-21-13(19)12-14(22-15)23(16(24)20-12)8-9-10(17)5-4-6-11(9)18/h4-6H,2-3,7-8H2,1H3,(H,20,24)(H2,19,21,22) |
| InChIKey | FFFXNCSCYRJTDZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|